C24H24O7 — CID 122680179
(4aR,5aS,12aR)-2-acetyl-10,11,12a-trihydroxy-3-methyl-9-(2-oxopropyl)-4a,5,5a,6-tetrahydro-4H-tetracene-1,12-dione (PubChem CID 122680179) has the molecular formula C24H24O7 and a molecular weight of 424.45 g/mol. Its IUPAC name is (4aR,5aS,12aR)-2-acetyl-10,11,12a-trihydroxy-3-methyl-9-(2-oxopropyl)-4a,5,5a,6-tetrahydro-4H-tetracene-1,12-dione.
| Compound Name | (4aR,5aS,12aR)-2-acetyl-10,11,12a-trihydroxy-3-methyl-9-(2-oxopropyl)-4a,5,5a,6-tetrahydro-4H-tetracene-1,12-dione |
|---|---|
| PubChem CID | 122680179 |
| Molecular Formula | C24H24O7 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | (4aR,5aS,12aR)-2-acetyl-10,11,12a-trihydroxy-3-methyl-9-(2-oxopropyl)-4a,5,5a,6-tetrahydro-4H-tetracene-1,12-dione |
| SMILES | CC(=O)Cc1ccc2c(c1O)C(O)=C1C(=O)[C@@]3(O)C(=O)C(C(C)=O)=C(C)C[C@H]3C[C@H]1C2 |
| InChI | InChI=1S/C24H24O7/c1-10-6-16-9-15-8-13-4-5-14(7-11(2)25)20(27)18(13)21(28)19(15)23(30)24(16,31)22(29)17(10)12(3)26/h4-5,15-16,27-28,31H,6-9H2,1-3H3/t15-,16+,24+/m1/s1 |
| InChIKey | YJHICZHIANIGLG-YPCHGGDPSA-N |
| XLogP | 2.16 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|