C28H32O7 — CID 118015071
2-acetyl-9-(cyclopentylmethyl)-5,10,11,12a-tetrahydroxy-3,6-dimethyl-4a,5,5a,6-tetrahydro-4H-tetracene-1,12-dione (PubChem CID 118015071) has the molecular formula C28H32O7 and a molecular weight of 480.56 g/mol. Its IUPAC name is 2-acetyl-9-(cyclopentylmethyl)-5,10,11,12a-tetrahydroxy-3,6-dimethyl-4a,5,5a,6-tetrahydro-4H-tetracene-1,12-dione.
| Compound Name | 2-acetyl-9-(cyclopentylmethyl)-5,10,11,12a-tetrahydroxy-3,6-dimethyl-4a,5,5a,6-tetrahydro-4H-tetracene-1,12-dione |
|---|---|
| PubChem CID | 118015071 |
| Molecular Formula | C28H32O7 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 2-acetyl-9-(cyclopentylmethyl)-5,10,11,12a-tetrahydroxy-3,6-dimethyl-4a,5,5a,6-tetrahydro-4H-tetracene-1,12-dione |
| SMILES | CC(=O)C1=C(C)CC2C(O)C3C(=C(O)c4c(ccc(CC5CCCC5)c4O)C3C)C(=O)C2(O)C1=O |
| InChI | InChI=1S/C28H32O7/c1-12-10-18-24(31)20-13(2)17-9-8-16(11-15-6-4-5-7-15)23(30)21(17)25(32)22(20)27(34)28(18,35)26(33)19(12)14(3)29/h8-9,13,15,18,20,24,30-32,35H,4-7,10-11H2,1-3H3 |
| InChIKey | QYNJCPDLVVHTPA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|