C29H28O5 — CID 122680403
(4aS,5aR,12aR)-10,11,12a-trihydroxy-3,9-dimethyl-7-phenyl-2-prop-1-en-2-yl-4a,5,5a,6-tetrahydro-4H-tetracene-1,12-dione (PubChem CID 122680403) has the molecular formula C29H28O5 and a molecular weight of 456.54 g/mol. Its IUPAC name is (4aS,5aR,12aR)-10,11,12a-trihydroxy-3,9-dimethyl-7-phenyl-2-prop-1-en-2-yl-4a,5,5a,6-tetrahydro-4H-tetracene-1,12-dione.
| Compound Name | (4aS,5aR,12aR)-10,11,12a-trihydroxy-3,9-dimethyl-7-phenyl-2-prop-1-en-2-yl-4a,5,5a,6-tetrahydro-4H-tetracene-1,12-dione |
|---|---|
| PubChem CID | 122680403 |
| Molecular Formula | C29H28O5 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | (4aS,5aR,12aR)-10,11,12a-trihydroxy-3,9-dimethyl-7-phenyl-2-prop-1-en-2-yl-4a,5,5a,6-tetrahydro-4H-tetracene-1,12-dione |
| SMILES | C=C(C)C1=C(C)C[C@@H]2C[C@@H]3Cc4c(-c5ccccc5)cc(C)c(O)c4C(O)=C3C(=O)[C@]2(O)C1=O |
| InChI | InChI=1S/C29H28O5/c1-14(2)22-15(3)10-19-12-18-13-21-20(17-8-6-5-7-9-17)11-16(4)25(30)24(21)26(31)23(18)28(33)29(19,34)27(22)32/h5-9,11,18-19,30-31,34H,1,10,12-13H2,2-4H3/t18-,19-,29-/m1/s1 |
| InChIKey | VPDNWGWNOZVXHF-VAVDGXSSSA-N |
| XLogP | 4.99 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|