C29H27F3N2O6 — CID 70832158
(4aS,5aR)-1,12,13-trihydroxy-3,14-dioxo-10-[[(2R)-2-(trifluoromethyl)pyrrolidin-1-yl]methyl]-4,4a,5,5a,6,14a-hexahydropentacene-2-carboxamide (PubChem CID 70832158) has the molecular formula C29H27F3N2O6 and a molecular weight of 556.54 g/mol. Its IUPAC name is (4aS,5aR)-1,12,13-trihydroxy-3,14-dioxo-10-[[(2R)-2-(trifluoromethyl)pyrrolidin-1-yl]methyl]-4,4a,5,5a,6,14a-hexahydropentacene-2-carboxamide.
| Compound Name | (4aS,5aR)-1,12,13-trihydroxy-3,14-dioxo-10-[[(2R)-2-(trifluoromethyl)pyrrolidin-1-yl]methyl]-4,4a,5,5a,6,14a-hexahydropentacene-2-carboxamide |
|---|---|
| PubChem CID | 70832158 |
| Molecular Formula | C29H27F3N2O6 |
| Molecular Weight | 556.54 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | (4aS,5aR)-1,12,13-trihydroxy-3,14-dioxo-10-[[(2R)-2-(trifluoromethyl)pyrrolidin-1-yl]methyl]-4,4a,5,5a,6,14a-hexahydropentacene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)C2C(=O)C3=C(O)c4c(cc5ccc(CN6CCC[C@@H]6C(F)(F)F)cc5c4O)C[C@H]3C[C@H]2CC1=O |
| InChI | InChI=1S/C29H27F3N2O6/c30-29(31,32)19-2-1-5-34(19)11-12-3-4-13-7-14-8-15-9-16-10-18(35)23(28(33)40)27(39)22(16)26(38)21(15)25(37)20(14)24(36)17(13)6-12/h3-4,6-7,15-16,19,22,36-37,39H,1-2,5,8-11H2,(H2,33,40)/t15-,16-,19+,22?/m0/s1 |
| InChIKey | JGCLNBPQEUPXAB-GCFDERSISA-N |
| XLogP | 3.99 |
| TPSA | 141.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|