C25H26FN3O7 — CID 90005229
(6aR,7aS)-5-fluoro-11,13,14-trihydroxy-2,9,12-trioxo-3-(propylamino)-3,4,6,6a,7,7a,8,11a-octahydro-1H-anthra[2,3-g]quinoline-10-carboxamide (PubChem CID 90005229) has the molecular formula C25H26FN3O7 and a molecular weight of 499.50 g/mol. Its IUPAC name is (6aR,7aS)-5-fluoro-11,13,14-trihydroxy-2,9,12-trioxo-3-(propylamino)-3,4,6,6a,7,7a,8,11a-octahydro-1H-anthra[2,3-g]quinoline-10-carboxamide.
| Compound Name | (6aR,7aS)-5-fluoro-11,13,14-trihydroxy-2,9,12-trioxo-3-(propylamino)-3,4,6,6a,7,7a,8,11a-octahydro-1H-anthra[2,3-g]quinoline-10-carboxamide |
|---|---|
| PubChem CID | 90005229 |
| Molecular Formula | C25H26FN3O7 |
| Molecular Weight | 499.50 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | (6aR,7aS)-5-fluoro-11,13,14-trihydroxy-2,9,12-trioxo-3-(propylamino)-3,4,6,6a,7,7a,8,11a-octahydro-1H-anthra[2,3-g]quinoline-10-carboxamide |
| SMILES | CCCNC1Cc2c(F)c3c(c(O)c2NC1=O)C(O)=C1C(=O)C2C(O)=C(C(N)=O)C(=O)C[C@@H]2C[C@@H]1C3 |
| InChI | InChI=1S/C25H26FN3O7/c1-2-3-28-12-7-11-18(26)10-5-8-4-9-6-13(30)17(24(27)35)22(33)15(9)20(31)14(8)21(32)16(10)23(34)19(11)29-25(12)36/h8-9,12,15,28,32-34H,2-7H2,1H3,(H2,27,35)(H,29,36)/t8-,9+,12?,15?/m1/s1 |
| InChIKey | XQGWNVROEYTNPJ-UCUIHIJHSA-N |
| XLogP | 1.31 |
| TPSA | 179.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.50 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|