C29H34FN3O8 — CID 148673481
(6aR,7aS,8S,11aR)-8-(dimethylamino)-5-fluoro-11,11a,13,14-tetrahydroxy-2,9,12-trioxo-3-pentyl-1,3,4,6,6a,7,7a,8-octahydroanthra[2,3-g]quinoline-10-carboxamide (PubChem CID 148673481) has the molecular formula C29H34FN3O8 and a molecular weight of 571.60 g/mol. Its IUPAC name is (6aR,7aS,8S,11aR)-8-(dimethylamino)-5-fluoro-11,11a,13,14-tetrahydroxy-2,9,12-trioxo-3-pentyl-1,3,4,6,6a,7,7a,8-octahydroanthra[2,3-g]quinoline-10-carboxamide.
| Compound Name | (6aR,7aS,8S,11aR)-8-(dimethylamino)-5-fluoro-11,11a,13,14-tetrahydroxy-2,9,12-trioxo-3-pentyl-1,3,4,6,6a,7,7a,8-octahydroanthra[2,3-g]quinoline-10-carboxamide |
|---|---|
| PubChem CID | 148673481 |
| Molecular Formula | C29H34FN3O8 |
| Molecular Weight | 571.60 g/mol |
| Exact Mass | 571.23 |
| IUPAC Name | (6aR,7aS,8S,11aR)-8-(dimethylamino)-5-fluoro-11,11a,13,14-tetrahydroxy-2,9,12-trioxo-3-pentyl-1,3,4,6,6a,7,7a,8-octahydroanthra[2,3-g]quinoline-10-carboxamide |
| SMILES | CCCCCC1Cc2c(F)c3c(c(O)c2NC1=O)C(O)=C1C(=O)[C@]2(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]2C[C@@H]1C3 |
| InChI | InChI=1S/C29H34FN3O8/c1-4-5-6-7-11-8-14-19(30)13-9-12-10-15-21(33(2)3)24(36)18(27(31)39)26(38)29(15,41)25(37)16(12)22(34)17(13)23(35)20(14)32-28(11)40/h11-12,15,21,34-35,38,41H,4-10H2,1-3H3,(H2,31,39)(H,32,40)/t11?,12-,15-,21-,29-/m0/s1 |
| InChIKey | SXUTZFDMZUFSNW-SIJCCIBXSA-N |
| XLogP | 1.79 |
| TPSA | 190.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.60 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|