C25H27FN2O7 — CID 121287968
(1R,15R,19S,20S)-19-[ethyl(methyl)amino]-4-fluoro-10,12,15,16-tetrahydroxy-14,18-dioxopentacyclo[11.8.0.03,11.05,9.015,20]henicosa-3,5(9),10,12,16-pentaene-17-carboxamide (PubChem CID 121287968) has the molecular formula C25H27FN2O7 and a molecular weight of 486.50 g/mol. Its IUPAC name is (1R,15R,19S,20S)-19-[ethyl(methyl)amino]-4-fluoro-10,12,15,16-tetrahydroxy-14,18-dioxopentacyclo[11.8.0.03,11.05,9.015,20]henicosa-3,5(9),10,12,16-pentaene-17-carboxamide.
| Compound Name | (1R,15R,19S,20S)-19-[ethyl(methyl)amino]-4-fluoro-10,12,15,16-tetrahydroxy-14,18-dioxopentacyclo[11.8.0.03,11.05,9.015,20]henicosa-3,5(9),10,12,16-pentaene-17-carboxamide |
|---|---|
| PubChem CID | 121287968 |
| Molecular Formula | C25H27FN2O7 |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | (1R,15R,19S,20S)-19-[ethyl(methyl)amino]-4-fluoro-10,12,15,16-tetrahydroxy-14,18-dioxopentacyclo[11.8.0.03,11.05,9.015,20]henicosa-3,5(9),10,12,16-pentaene-17-carboxamide |
| SMILES | CCN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)c5c(c(F)c4C[C@H]3C[C@@H]12)CCC5 |
| InChI | InChI=1S/C25H27FN2O7/c1-3-28(2)18-13-8-9-7-12-15(19(29)11-6-4-5-10(11)17(12)26)20(30)14(9)22(32)25(13,35)23(33)16(21(18)31)24(27)34/h9,13,18,29-30,33,35H,3-8H2,1-2H3,(H2,27,34)/t9-,13-,18-,25-/m0/s1 |
| InChIKey | DQMWAXNUVLDQSN-XHYXRWKMSA-N |
| XLogP | 0.98 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|