C24H30N4O7 — CID 73387764
(6aR,10S,10aS,11aR)-1-(dimethylamino)-4,5,6a,7-tetrahydroxy-10-[methyl(propyl)amino]-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-naphtho[3,2-g]isoquinoline-8-carboxamide (PubChem CID 73387764) has the molecular formula C24H30N4O7 and a molecular weight of 486.53 g/mol. Its IUPAC name is (6aR,10S,10aS,11aR)-1-(dimethylamino)-4,5,6a,7-tetrahydroxy-10-[methyl(propyl)amino]-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-naphtho[3,2-g]isoquinoline-8-carboxamide.
| Compound Name | (6aR,10S,10aS,11aR)-1-(dimethylamino)-4,5,6a,7-tetrahydroxy-10-[methyl(propyl)amino]-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-naphtho[3,2-g]isoquinoline-8-carboxamide |
|---|---|
| PubChem CID | 73387764 |
| Molecular Formula | C24H30N4O7 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | (6aR,10S,10aS,11aR)-1-(dimethylamino)-4,5,6a,7-tetrahydroxy-10-[methyl(propyl)amino]-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-naphtho[3,2-g]isoquinoline-8-carboxamide |
| SMILES | CCCN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cnc(N(C)C)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C24H30N4O7/c1-5-6-28(4)17-12-8-10-7-11-15(13(29)9-26-23(11)27(2)3)18(30)14(10)20(32)24(12,35)21(33)16(19(17)31)22(25)34/h9-10,12,17,29-30,33,35H,5-8H2,1-4H3,(H2,25,34)/t10-,12-,17-,24-/m0/s1 |
| InChIKey | FAQCDCUFJTYHGM-KGWNKILJSA-N |
| XLogP | 0.21 |
| TPSA | 177.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|