C26H34N4O7 — CID 121287975
(6aR,10S,10aS,11aR)-1-(dimethylamino)-10-(dipropylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-naphtho[3,2-g]isoquinoline-8-carboxamide (PubChem CID 121287975) has the molecular formula C26H34N4O7 and a molecular weight of 514.58 g/mol. Its IUPAC name is (6aR,10S,10aS,11aR)-1-(dimethylamino)-10-(dipropylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-naphtho[3,2-g]isoquinoline-8-carboxamide.
| Compound Name | (6aR,10S,10aS,11aR)-1-(dimethylamino)-10-(dipropylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-naphtho[3,2-g]isoquinoline-8-carboxamide |
|---|---|
| PubChem CID | 121287975 |
| Molecular Formula | C26H34N4O7 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | (6aR,10S,10aS,11aR)-1-(dimethylamino)-10-(dipropylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-naphtho[3,2-g]isoquinoline-8-carboxamide |
| SMILES | CCCN(CCC)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cnc(N(C)C)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C26H34N4O7/c1-5-7-30(8-6-2)19-14-10-12-9-13-17(15(31)11-28-25(13)29(3)4)20(32)16(12)22(34)26(14,37)23(35)18(21(19)33)24(27)36/h11-12,14,19,31-32,35,37H,5-10H2,1-4H3,(H2,27,36)/t12-,14-,19-,26-/m0/s1 |
| InChIKey | RQKOKQWYTSAKKI-OWLUCLAESA-N |
| XLogP | 0.99 |
| TPSA | 177.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|