C30H37FN4O8 — CID 121288141
(6aS,7aR,8R,11aS)-8-(dimethylamino)-3-(dipropylamino)-5-fluoro-11,11a,13,14-tetrahydroxy-2,9,12-trioxo-1,3,4,6,6a,7,7a,8-octahydroanthra[2,3-g]quinoline-10-carboxamide (PubChem CID 121288141) has the molecular formula C30H37FN4O8 and a molecular weight of 600.64 g/mol. Its IUPAC name is (6aS,7aR,8R,11aS)-8-(dimethylamino)-3-(dipropylamino)-5-fluoro-11,11a,13,14-tetrahydroxy-2,9,12-trioxo-1,3,4,6,6a,7,7a,8-octahydroanthra[2,3-g]quinoline-10-carboxamide.
| Compound Name | (6aS,7aR,8R,11aS)-8-(dimethylamino)-3-(dipropylamino)-5-fluoro-11,11a,13,14-tetrahydroxy-2,9,12-trioxo-1,3,4,6,6a,7,7a,8-octahydroanthra[2,3-g]quinoline-10-carboxamide |
|---|---|
| PubChem CID | 121288141 |
| Molecular Formula | C30H37FN4O8 |
| Molecular Weight | 600.64 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | (6aS,7aR,8R,11aS)-8-(dimethylamino)-3-(dipropylamino)-5-fluoro-11,11a,13,14-tetrahydroxy-2,9,12-trioxo-1,3,4,6,6a,7,7a,8-octahydroanthra[2,3-g]quinoline-10-carboxamide |
| SMILES | CCCN(CCC)C1Cc2c(F)c3c(c(O)c2NC1=O)C(O)=C1C(=O)[C@@]2(O)C(O)=C(C(N)=O)C(=O)[C@H](N(C)C)[C@H]2C[C@H]1C3 |
| InChI | InChI=1S/C30H37FN4O8/c1-5-7-35(8-6-2)16-11-14-20(31)13-9-12-10-15-22(34(3)4)25(38)19(28(32)41)27(40)30(15,43)26(39)17(12)23(36)18(13)24(37)21(14)33-29(16)42/h12,15-16,22,36-37,40,43H,5-11H2,1-4H3,(H2,32,41)(H,33,42)/t12-,15-,16?,22-,30-/m1/s1 |
| InChIKey | PMDFAGMJGUMENJ-OXZWZROOSA-N |
| XLogP | 1.09 |
| TPSA | 193.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.64 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|