C30H37F2N3O7 — CID 162561860
(4S,4aS,5aR,12aR)-9-[(4,4-difluoropiperidin-1-yl)methyl]-4-(dimethylamino)-7-ethyl-1,10,11-trihydroxy-12a-methoxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 162561860) has the molecular formula C30H37F2N3O7 and a molecular weight of 589.64 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-9-[(4,4-difluoropiperidin-1-yl)methyl]-4-(dimethylamino)-7-ethyl-1,10,11-trihydroxy-12a-methoxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-9-[(4,4-difluoropiperidin-1-yl)methyl]-4-(dimethylamino)-7-ethyl-1,10,11-trihydroxy-12a-methoxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 162561860 |
| Molecular Formula | C30H37F2N3O7 |
| Molecular Weight | 589.64 g/mol |
| Exact Mass | 589.26 |
| IUPAC Name | (4S,4aS,5aR,12aR)-9-[(4,4-difluoropiperidin-1-yl)methyl]-4-(dimethylamino)-7-ethyl-1,10,11-trihydroxy-12a-methoxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCc1cc(CN2CCC(F)(F)CC2)c(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(OC)C(=O)C1=C2O |
| InChI | InChI=1S/C30H37F2N3O7/c1-5-14-10-16(13-35-8-6-29(31,32)7-9-35)23(36)20-17(14)11-15-12-18-22(34(2)3)25(38)21(28(33)41)27(40)30(18,42-4)26(39)19(15)24(20)37/h10,15,18,22,36-37,40H,5-9,11-13H2,1-4H3,(H2,33,41)/t15-,18-,22-,30-/m0/s1 |
| InChIKey | SICAXDGDPHKULQ-PBBIGZQSSA-N |
| XLogP | 2.41 |
| TPSA | 153.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.64 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|