C25H31N3O8 — CID 163633389
(4S,4aS,5aR,12aR)-4-(dimethylamino)-9-[(ethoxyamino)methyl]-1,10,11-trihydroxy-12a-methoxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 163633389) has the molecular formula C25H31N3O8 and a molecular weight of 501.54 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4-(dimethylamino)-9-[(ethoxyamino)methyl]-1,10,11-trihydroxy-12a-methoxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-9-[(ethoxyamino)methyl]-1,10,11-trihydroxy-12a-methoxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 163633389 |
| Molecular Formula | C25H31N3O8 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-9-[(ethoxyamino)methyl]-1,10,11-trihydroxy-12a-methoxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCONCc1ccc2c(c1O)C(O)=C1C(=O)[C@]3(OC)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C25H31N3O8/c1-5-36-27-10-12-7-6-11-8-13-9-14-18(28(2)3)21(31)17(24(26)34)23(33)25(14,35-4)22(32)16(13)20(30)15(11)19(12)29/h6-7,13-14,18,27,29-30,33H,5,8-10H2,1-4H3,(H2,26,34)/t13-,14-,18-,25-/m0/s1 |
| InChIKey | LLKRQECDDIPOLS-CCCGNOGTSA-N |
| XLogP | 0.66 |
| TPSA | 171.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|