C24H26N2O7 — CID 71084215
(4S,4aS,5aR,12aR)-7-acetyl-4-(dimethylamino)-1,11-dihydroxy-12a-methoxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 71084215) has the molecular formula C24H26N2O7 and a molecular weight of 454.48 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-7-acetyl-4-(dimethylamino)-1,11-dihydroxy-12a-methoxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-7-acetyl-4-(dimethylamino)-1,11-dihydroxy-12a-methoxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 71084215 |
| Molecular Formula | C24H26N2O7 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | (4S,4aS,5aR,12aR)-7-acetyl-4-(dimethylamino)-1,11-dihydroxy-12a-methoxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CO[C@]12C(=O)C3=C(O)c4cccc(C(C)=O)c4C[C@H]3C[C@H]1[C@H](N(C)C)C(=O)C(C(N)=O)=C2O |
| InChI | InChI=1S/C24H26N2O7/c1-10(27)12-6-5-7-13-14(12)8-11-9-15-18(26(2)3)20(29)17(23(25)32)22(31)24(15,33-4)21(30)16(11)19(13)28/h5-7,11,15,18,28,31H,8-9H2,1-4H3,(H2,25,32)/t11-,15-,18-,24-/m0/s1 |
| InChIKey | APTXLYHQQFMOIW-FZGGGFBKSA-N |
| XLogP | 1.12 |
| TPSA | 147.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|