C26H31N3O8 — CID 89259898
(4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11-trihydroxy-12a-methoxy-3,12-dioxo-7-[(prop-2-enoxyamino)methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 89259898) has the molecular formula C26H31N3O8 and a molecular weight of 513.55 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11-trihydroxy-12a-methoxy-3,12-dioxo-7-[(prop-2-enoxyamino)methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11-trihydroxy-12a-methoxy-3,12-dioxo-7-[(prop-2-enoxyamino)methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 89259898 |
| Molecular Formula | C26H31N3O8 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11-trihydroxy-12a-methoxy-3,12-dioxo-7-[(prop-2-enoxyamino)methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | C=CCONCc1ccc(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(OC)C(=O)C1=C2O |
| InChI | InChI=1S/C26H31N3O8/c1-5-8-37-28-11-12-6-7-16(30)18-14(12)9-13-10-15-20(29(2)3)22(32)19(25(27)35)24(34)26(15,36-4)23(33)17(13)21(18)31/h5-7,13,15,20,28,30-31,34H,1,8-11H2,2-4H3,(H2,27,35)/t13-,15-,20-,26-/m0/s1 |
| InChIKey | AZEBNGFNTRJCGR-AVZBAUEKSA-N |
| XLogP | 0.83 |
| TPSA | 171.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|