C24H26N2O8 — CID 67629533
methyl (5aR,6aS,7S,10aR)-9-carbamoyl-7-(dimethylamino)-10,12-dihydroxy-10a-methoxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracene-1-carboxylate (PubChem CID 67629533) has the molecular formula C24H26N2O8 and a molecular weight of 470.48 g/mol. Its IUPAC name is methyl (5aR,6aS,7S,10aR)-9-carbamoyl-7-(dimethylamino)-10,12-dihydroxy-10a-methoxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracene-1-carboxylate.
| Compound Name | methyl (5aR,6aS,7S,10aR)-9-carbamoyl-7-(dimethylamino)-10,12-dihydroxy-10a-methoxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracene-1-carboxylate |
|---|---|
| PubChem CID | 67629533 |
| Molecular Formula | C24H26N2O8 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | methyl (5aR,6aS,7S,10aR)-9-carbamoyl-7-(dimethylamino)-10,12-dihydroxy-10a-methoxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracene-1-carboxylate |
| SMILES | COC(=O)c1cccc2c1C(O)=C1C(=O)[C@]3(OC)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C24H26N2O8/c1-26(2)17-13-9-11-8-10-6-5-7-12(23(32)33-3)14(10)18(27)15(11)20(29)24(13,34-4)21(30)16(19(17)28)22(25)31/h5-7,11,13,17,27,30H,8-9H2,1-4H3,(H2,25,31)/t11-,13-,17-,24-/m0/s1 |
| InChIKey | CAXGYNATOWBTHY-IUEXHHGTSA-N |
| XLogP | 0.70 |
| TPSA | 156.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|