C29H34N2O7 — CID 68635798
(4S,4aS,5aR,12aR)-9-(cyclohexen-1-yl)-4-(dimethylamino)-7-ethyl-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 68635798) has the molecular formula C29H34N2O7 and a molecular weight of 522.60 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-9-(cyclohexen-1-yl)-4-(dimethylamino)-7-ethyl-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-9-(cyclohexen-1-yl)-4-(dimethylamino)-7-ethyl-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 68635798 |
| Molecular Formula | C29H34N2O7 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | (4S,4aS,5aR,12aR)-9-(cyclohexen-1-yl)-4-(dimethylamino)-7-ethyl-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCc1cc(C2=CCCCC2)c(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C29H34N2O7/c1-4-13-10-17(14-8-6-5-7-9-14)23(32)20-16(13)11-15-12-18-22(31(2)3)25(34)21(28(30)37)27(36)29(18,38)26(35)19(15)24(20)33/h8,10,15,18,22,32-33,36,38H,4-7,9,11-12H2,1-3H3,(H2,30,37)/t15-,18-,22-,29-/m0/s1 |
| InChIKey | DWQHBSRTZNBFRK-MGVDVOGZSA-N |
| XLogP | 2.48 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|