C28H32F3N5O7 — CID 123921885
9-[ethyl(methyl)amino]-5,25-dihydroxy-6-imino-2,4,8-trioxo-15-(trifluoromethoxy)-18,23-diazahexacyclo[12.11.0.03,12.05,10.016,24.017,21]pentacosa-1(14),15,24-triene-7-carboxamide (PubChem CID 123921885) has the molecular formula C28H32F3N5O7 and a molecular weight of 607.59 g/mol. Its IUPAC name is 9-[ethyl(methyl)amino]-5,25-dihydroxy-6-imino-2,4,8-trioxo-15-(trifluoromethoxy)-18,23-diazahexacyclo[12.11.0.03,12.05,10.016,24.017,21]pentacosa-1(14),15,24-triene-7-carboxamide.
| Compound Name | 9-[ethyl(methyl)amino]-5,25-dihydroxy-6-imino-2,4,8-trioxo-15-(trifluoromethoxy)-18,23-diazahexacyclo[12.11.0.03,12.05,10.016,24.017,21]pentacosa-1(14),15,24-triene-7-carboxamide |
|---|---|
| PubChem CID | 123921885 |
| Molecular Formula | C28H32F3N5O7 |
| Molecular Weight | 607.59 g/mol |
| Exact Mass | 607.23 |
| IUPAC Name | 9-[ethyl(methyl)amino]-5,25-dihydroxy-6-imino-2,4,8-trioxo-15-(trifluoromethoxy)-18,23-diazahexacyclo[12.11.0.03,12.05,10.016,24.017,21]pentacosa-1(14),15,24-triene-7-carboxamide |
| SMILES | [H]/N=C1\C(C(N)=O)C(=O)C(N(C)CC)C2CC3Cc4c(OC(F)(F)F)c5c(c(O)c4C(=O)C3C(=O)C12O)NCC1CCNC51 |
| InChI | InChI=1S/C28H32F3N5O7/c1-3-36(2)19-12-7-10-6-11-14(20(37)13(10)25(40)27(12,42)24(32)16(22(19)39)26(33)41)21(38)18-15(23(11)43-28(29,30)31)17-9(8-35-18)4-5-34-17/h9-10,12-13,16-17,19,32,34-35,38,42H,3-8H2,1-2H3,(H2,33,41)/b32-24+ |
| InChIKey | PNKQRDPMJAWDMQ-FEZSWGLMSA-N |
| XLogP | 0.68 |
| TPSA | 195.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.59 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|