C26H28F3N3O8 — CID 123964956
4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-8-pyrrolidin-2-yl-7-(trifluoromethoxy)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123964956) has the molecular formula C26H28F3N3O8 and a molecular weight of 567.52 g/mol. Its IUPAC name is 4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-8-pyrrolidin-2-yl-7-(trifluoromethoxy)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-8-pyrrolidin-2-yl-7-(trifluoromethoxy)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123964956 |
| Molecular Formula | C26H28F3N3O8 |
| Molecular Weight | 567.52 g/mol |
| Exact Mass | 567.18 |
| IUPAC Name | 4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-8-pyrrolidin-2-yl-7-(trifluoromethoxy)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)C1C(=O)C(C(N)=O)C(=O)C2(O)C(=O)C3C(=O)c4c(O)cc(C5CCCN5)c(OC(F)(F)F)c4CC3CC12 |
| InChI | InChI=1S/C26H28F3N3O8/c1-32(2)18-12-7-9-6-11-16(14(33)8-10(13-4-3-5-31-13)21(11)40-26(27,28)29)19(34)15(9)22(36)25(12,39)23(37)17(20(18)35)24(30)38/h8-9,12-13,15,17-18,31,33,39H,3-7H2,1-2H3,(H2,30,38) |
| InChIKey | LLCLDQCYVQOWBW-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 176.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.52 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|