C28H34FN3O7 — CID 123316828
4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-8-(1-propan-2-ylpyrrolidin-2-yl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123316828) has the molecular formula C28H34FN3O7 and a molecular weight of 543.59 g/mol. Its IUPAC name is 4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-8-(1-propan-2-ylpyrrolidin-2-yl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-8-(1-propan-2-ylpyrrolidin-2-yl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123316828 |
| Molecular Formula | C28H34FN3O7 |
| Molecular Weight | 543.59 g/mol |
| Exact Mass | 543.24 |
| IUPAC Name | 4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-8-(1-propan-2-ylpyrrolidin-2-yl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC(C)N1CCCC1c1cc(O)c2c(c1F)CC1CC3C(N(C)C)C(=O)C(C(N)=O)C(=O)C3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C28H34FN3O7/c1-11(2)32-7-5-6-16(32)13-10-17(33)19-14(21(13)29)8-12-9-15-22(31(3)4)24(35)20(27(30)38)26(37)28(15,39)25(36)18(12)23(19)34/h10-12,15-16,18,20,22,33,39H,5-9H2,1-4H3,(H2,30,38) |
| InChIKey | YQVXMSIDEZWOFH-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 158.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.59 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|