C30H40N4O7 — CID 123325221
4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-8-(1-propan-2-ylpyrrolidin-2-yl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123325221) has the molecular formula C30H40N4O7 and a molecular weight of 568.67 g/mol. Its IUPAC name is 4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-8-(1-propan-2-ylpyrrolidin-2-yl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-8-(1-propan-2-ylpyrrolidin-2-yl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123325221 |
| Molecular Formula | C30H40N4O7 |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | 4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-8-(1-propan-2-ylpyrrolidin-2-yl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC(C)N1CCCC1c1cc(O)c2c(c1N(C)C)CC1CC3C(N(C)C)C(=O)C(C(N)=O)C(=O)C3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C30H40N4O7/c1-13(2)34-9-7-8-18(34)15-12-19(35)21-16(23(15)32(3)4)10-14-11-17-24(33(5)6)26(37)22(29(31)40)28(39)30(17,41)27(38)20(14)25(21)36/h12-14,17-18,20,22,24,35,41H,7-11H2,1-6H3,(H2,31,40) |
| InChIKey | ZIDAUNSLUGQCET-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 161.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|