C25H29FN4O6 — CID 123206788
4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1-imino-3,11,12-trioxo-8-pyrrolidin-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123206788) has the molecular formula C25H29FN4O6 and a molecular weight of 500.53 g/mol. Its IUPAC name is 4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1-imino-3,11,12-trioxo-8-pyrrolidin-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1-imino-3,11,12-trioxo-8-pyrrolidin-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123206788 |
| Molecular Formula | C25H29FN4O6 |
| Molecular Weight | 500.53 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | 4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1-imino-3,11,12-trioxo-8-pyrrolidin-2-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | [H]/N=C1\C(C(N)=O)C(=O)C(N(C)C)C2CC3Cc4c(F)c(C5CCCN5)cc(O)c4C(=O)C3C(=O)C12O |
| InChI | InChI=1S/C25H29FN4O6/c1-30(2)19-12-7-9-6-11-16(14(31)8-10(18(11)26)13-4-3-5-29-13)20(32)15(9)23(34)25(12,36)22(27)17(21(19)33)24(28)35/h8-9,12-13,15,17,19,27,29,31,36H,3-7H2,1-2H3,(H2,28,35)/b27-22+ |
| InChIKey | SPBFAPSEYZXZQD-HPNDGRJYSA-N |
| XLogP | -0.12 |
| TPSA | 173.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.53 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|