C26H31FN4O6 — CID 90993122
4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1-imino-8-[(2-methylazetidin-1-yl)methyl]-3,11,12-trioxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90993122) has the molecular formula C26H31FN4O6 and a molecular weight of 514.55 g/mol. Its IUPAC name is 4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1-imino-8-[(2-methylazetidin-1-yl)methyl]-3,11,12-trioxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1-imino-8-[(2-methylazetidin-1-yl)methyl]-3,11,12-trioxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90993122 |
| Molecular Formula | C26H31FN4O6 |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | 4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1-imino-8-[(2-methylazetidin-1-yl)methyl]-3,11,12-trioxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | [H]/N=C1\C(C(N)=O)C(=O)C(N(C)C)C2CC3Cc4c(F)c(CN5CCC5C)cc(O)c4C(=O)C3C(=O)C12O |
| InChI | InChI=1S/C26H31FN4O6/c1-10-4-5-31(10)9-12-8-15(32)17-13(19(12)27)6-11-7-14-20(30(2)3)22(34)18(25(29)36)23(28)26(14,37)24(35)16(11)21(17)33/h8,10-11,14,16,18,20,28,32,37H,4-7,9H2,1-3H3,(H2,29,36)/b28-23+ |
| InChIKey | NJNPLGBWKGNFCX-WEMUOSSPSA-N |
| XLogP | 0.05 |
| TPSA | 165.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|