C25H26FN5O6 — CID 123504707
4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1-imino-8-(1-methylimidazol-2-yl)-3,11,12-trioxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123504707) has the molecular formula C25H26FN5O6 and a molecular weight of 511.51 g/mol. Its IUPAC name is 4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1-imino-8-(1-methylimidazol-2-yl)-3,11,12-trioxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1-imino-8-(1-methylimidazol-2-yl)-3,11,12-trioxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123504707 |
| Molecular Formula | C25H26FN5O6 |
| Molecular Weight | 511.51 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | 4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1-imino-8-(1-methylimidazol-2-yl)-3,11,12-trioxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | [H]/N=C1\C(C(N)=O)C(=O)C(N(C)C)C2CC3Cc4c(F)c(-c5nccn5C)cc(O)c4C(=O)C3C(=O)C12O |
| InChI | InChI=1S/C25H26FN5O6/c1-30(2)18-12-7-9-6-10-15(13(32)8-11(17(10)26)24-29-4-5-31(24)3)19(33)14(9)22(35)25(12,37)21(27)16(20(18)34)23(28)36/h4-5,8-9,12,14,16,18,27,32,37H,6-7H2,1-3H3,(H2,28,36)/b27-21+ |
| InChIKey | DYULCDKSELPFJX-SZXQPVLSSA-N |
| XLogP | -0.14 |
| TPSA | 179.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.51 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|