C26H26ClN5O5 — CID 123194221
7-chloro-4-(dimethylamino)-10,12a-dihydroxy-1-imino-3,11,12-trioxo-8-pyridin-3-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboximidamide (PubChem CID 123194221) has the molecular formula C26H26ClN5O5 and a molecular weight of 523.98 g/mol. Its IUPAC name is 7-chloro-4-(dimethylamino)-10,12a-dihydroxy-1-imino-3,11,12-trioxo-8-pyridin-3-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboximidamide.
| Compound Name | 7-chloro-4-(dimethylamino)-10,12a-dihydroxy-1-imino-3,11,12-trioxo-8-pyridin-3-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboximidamide |
|---|---|
| PubChem CID | 123194221 |
| Molecular Formula | C26H26ClN5O5 |
| Molecular Weight | 523.98 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | 7-chloro-4-(dimethylamino)-10,12a-dihydroxy-1-imino-3,11,12-trioxo-8-pyridin-3-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboximidamide |
| SMILES | [H]/N=C(\N)C1C(=O)C(N(C)C)C2CC3Cc4c(Cl)c(-c5cccnc5)cc(O)c4C(=O)C3C(=O)C2(O)/C1=N/[H] |
| InChI | InChI=1S/C26H26ClN5O5/c1-32(2)20-14-7-11-6-13-17(15(33)8-12(19(13)27)10-4-3-5-31-9-10)21(34)16(11)24(36)26(14,37)23(28)18(22(20)35)25(29)30/h3-5,8-9,11,14,16,18,20,28,33,37H,6-7H2,1-2H3,(H3,29,30)/b28-23+ |
| InChIKey | PBJUXGMEYVGXJY-WEMUOSSPSA-N |
| XLogP | 1.48 |
| TPSA | 181.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.98 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|