C26H29F3N4O7 — CID 123228390
4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-8-piperazin-2-yl-7-(trifluoromethyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123228390) has the molecular formula C26H29F3N4O7 and a molecular weight of 566.53 g/mol. Its IUPAC name is 4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-8-piperazin-2-yl-7-(trifluoromethyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-8-piperazin-2-yl-7-(trifluoromethyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123228390 |
| Molecular Formula | C26H29F3N4O7 |
| Molecular Weight | 566.53 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | 4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-8-piperazin-2-yl-7-(trifluoromethyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)C1C(=O)C(C(N)=O)C(=O)C2(O)C(=O)C3C(=O)c4c(O)cc(C5CNCCN5)c(C(F)(F)F)c4CC3CC12 |
| InChI | InChI=1S/C26H29F3N4O7/c1-33(2)19-12-6-9-5-11-16(14(34)7-10(18(11)26(27,28)29)13-8-31-3-4-32-13)20(35)15(9)22(37)25(12,40)23(38)17(21(19)36)24(30)39/h7,9,12-13,15,17,19,31-32,34,40H,3-6,8H2,1-2H3,(H2,30,39) |
| InChIKey | VDCZPMVONNRVBP-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 179.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.53 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|