C29H35N3O8 — CID 123943173
4-(dimethylamino)-8-(3-ethyl-3-azabicyclo[3.1.0]hexan-2-yl)-10,12a-dihydroxy-7-methoxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123943173) has the molecular formula C29H35N3O8 and a molecular weight of 553.61 g/mol. Its IUPAC name is 4-(dimethylamino)-8-(3-ethyl-3-azabicyclo[3.1.0]hexan-2-yl)-10,12a-dihydroxy-7-methoxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-8-(3-ethyl-3-azabicyclo[3.1.0]hexan-2-yl)-10,12a-dihydroxy-7-methoxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123943173 |
| Molecular Formula | C29H35N3O8 |
| Molecular Weight | 553.61 g/mol |
| Exact Mass | 553.24 |
| IUPAC Name | 4-(dimethylamino)-8-(3-ethyl-3-azabicyclo[3.1.0]hexan-2-yl)-10,12a-dihydroxy-7-methoxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CCN1CC2CC2C1c1cc(O)c2c(c1OC)CC1CC3C(N(C)C)C(=O)C(C(N)=O)C(=O)C3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C29H35N3O8/c1-5-32-10-12-7-13(12)21(32)15-9-17(33)19-14(25(15)40-4)6-11-8-16-22(31(2)3)24(35)20(28(30)38)27(37)29(16,39)26(36)18(11)23(19)34/h9,11-13,16,18,20-22,33,39H,5-8,10H2,1-4H3,(H2,30,38) |
| InChIKey | NFEFEHSNZOCMSM-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 167.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.61 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|