C28H31N3O8 — CID 123259249
4-(dimethylamino)-10,12a-dihydroxy-7-methoxy-8-(3-methyl-3-azabicyclo[3.1.0]hex-5-en-2-yl)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123259249) has the molecular formula C28H31N3O8 and a molecular weight of 537.57 g/mol. Its IUPAC name is 4-(dimethylamino)-10,12a-dihydroxy-7-methoxy-8-(3-methyl-3-azabicyclo[3.1.0]hex-5-en-2-yl)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-10,12a-dihydroxy-7-methoxy-8-(3-methyl-3-azabicyclo[3.1.0]hex-5-en-2-yl)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123259249 |
| Molecular Formula | C28H31N3O8 |
| Molecular Weight | 537.57 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | 4-(dimethylamino)-10,12a-dihydroxy-7-methoxy-8-(3-methyl-3-azabicyclo[3.1.0]hex-5-en-2-yl)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | COc1c(C2C3C=C3CN2C)cc(O)c2c1CC1CC3C(N(C)C)C(=O)C(C(N)=O)C(=O)C3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C28H31N3O8/c1-30(2)21-15-7-10-5-13-18(16(32)8-14(24(13)39-4)20-12-6-11(12)9-31(20)3)22(33)17(10)25(35)28(15,38)26(36)19(23(21)34)27(29)37/h6,8,10,12,15,17,19-21,32,38H,5,7,9H2,1-4H3,(H2,29,37) |
| InChIKey | XEFJIMDTHJOPPQ-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 167.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.57 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|