C7H8F3N3 — CID 102108005
5-but-3-enyl-3-(trifluoromethyl)-1H-1,2,4-triazole (PubChem CID 102108005) has the molecular formula C7H8F3N3 and a molecular weight of 191.16 g/mol. Its IUPAC name is 5-but-3-enyl-3-(trifluoromethyl)-1H-1,2,4-triazole.
| Compound Name | 5-but-3-enyl-3-(trifluoromethyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 102108005 |
| Molecular Formula | C7H8F3N3 |
| Molecular Weight | 191.16 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 5-but-3-enyl-3-(trifluoromethyl)-1H-1,2,4-triazole |
| SMILES | C=CCCc1nc(C(F)(F)F)n[nH]1 |
| InChI | InChI=1S/C7H8F3N3/c1-2-3-4-5-11-6(13-12-5)7(8,9)10/h2H,1,3-4H2,(H,11,12,13) |
| InChIKey | IBAZIEQXQZNJHX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.16 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|