C7H12F3N3 — CID 145329480
ethane;5-ethyl-3-(trifluoromethyl)-1H-1,2,4-triazole (PubChem CID 145329480) has the molecular formula C7H12F3N3 and a molecular weight of 195.19 g/mol. Its IUPAC name is ethane;5-ethyl-3-(trifluoromethyl)-1H-1,2,4-triazole.
| Compound Name | ethane;5-ethyl-3-(trifluoromethyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 145329480 |
| Molecular Formula | C7H12F3N3 |
| Molecular Weight | 195.19 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | ethane;5-ethyl-3-(trifluoromethyl)-1H-1,2,4-triazole |
| SMILES | CC.CCc1nc(C(F)(F)F)n[nH]1 |
| InChI | InChI=1S/C5H6F3N3.C2H6/c1-2-3-9-4(11-10-3)5(6,7)8;1-2/h2H2,1H3,(H,9,10,11);1-2H3 |
| InChIKey | YGPACQMFZFUADJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.19 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |