C11H20NO6PS — CID 102110453
4-(3-diethoxyphosphorylpropylsulfanylmethyl)-1,3-oxazolidine-2,5-dione (PubChem CID 102110453) has the molecular formula C11H20NO6PS and a molecular weight of 325.32 g/mol. Its IUPAC name is 4-(3-diethoxyphosphorylpropylsulfanylmethyl)-1,3-oxazolidine-2,5-dione.
| Compound Name | 4-(3-diethoxyphosphorylpropylsulfanylmethyl)-1,3-oxazolidine-2,5-dione |
|---|---|
| PubChem CID | 102110453 |
| Molecular Formula | C11H20NO6PS |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 4-(3-diethoxyphosphorylpropylsulfanylmethyl)-1,3-oxazolidine-2,5-dione |
| SMILES | CCOP(=O)(CCCSCC1NC(=O)OC1=O)OCC |
| InChI | InChI=1S/C11H20NO6PS/c1-3-16-19(15,17-4-2)6-5-7-20-8-9-10(13)18-11(14)12-9/h9H,3-8H2,1-2H3,(H,12,14) |
| InChIKey | PSTKGFHUJLKYRB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|