C30H22N4O4S4 — CID 102113372
4-methyl-N-[17-[(4-methylphenyl)sulfonylamino]-5,8-dithia-13,20-diazapentacyclo[10.8.0.02,6.07,11.014,19]icosa-1(20),2(6),3,7(11),9,12,14,16,18-nonaen-16-yl]benzenesulfonamide (PubChem CID 102113372) has the molecular formula C30H22N4O4S4 and a molecular weight of 630.80 g/mol. Its IUPAC name is 4-methyl-N-[17-[(4-methylphenyl)sulfonylamino]-5,8-dithia-13,20-diazapentacyclo[10.8.0.02,6.07,11.014,19]icosa-1(20),2(6),3,7(11),9,12,14,16,18-nonaen-16-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[17-[(4-methylphenyl)sulfonylamino]-5,8-dithia-13,20-diazapentacyclo[10.8.0.02,6.07,11.014,19]icosa-1(20),2(6),3,7(11),9,12,14,16,18-nonaen-16-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 102113372 |
| Molecular Formula | C30H22N4O4S4 |
| Molecular Weight | 630.80 g/mol |
| Exact Mass | 630.05 |
| IUPAC Name | 4-methyl-N-[17-[(4-methylphenyl)sulfonylamino]-5,8-dithia-13,20-diazapentacyclo[10.8.0.02,6.07,11.014,19]icosa-1(20),2(6),3,7(11),9,12,14,16,18-nonaen-16-yl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc3nc4c5ccsc5c5sccc5c4nc3cc2NS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C30H22N4O4S4/c1-17-3-7-19(8-4-17)41(35,36)33-25-15-23-24(16-26(25)34-42(37,38)20-9-5-18(2)6-10-20)32-28-22-12-14-40-30(22)29-21(11-13-39-29)27(28)31-23/h3-16,33-34H,1-2H3 |
| InChIKey | UQPKALZZEFLSCA-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.80 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|