C16H19F3O5 — CID 102116130
(1R)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,2,2-trifluoroethanol (PubChem CID 102116130) has the molecular formula C16H19F3O5 and a molecular weight of 348.32 g/mol. Its IUPAC name is (1R)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,2,2-trifluoroethanol.
| Compound Name | (1R)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 102116130 |
| Molecular Formula | C16H19F3O5 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | (1R)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,2,2-trifluoroethanol |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@@H](O)C(F)(F)F)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C16H19F3O5/c1-15(2)23-12-10(21-8-9-6-4-3-5-7-9)11(22-14(12)24-15)13(20)16(17,18)19/h3-7,10-14,20H,8H2,1-2H3/t10-,11-,12+,13+,14+/m0/s1 |
| InChIKey | QGJIGXAQSXPIDY-ODXJTPSBSA-N |
| XLogP | 2.37 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |