C17H33NO3 — CID 102116780
2-[2-hydroxyhexyl(pentyl)amino]ethyl (E)-but-2-enoate (PubChem CID 102116780) has the molecular formula C17H33NO3 and a molecular weight of 299.45 g/mol. Its IUPAC name is 2-[2-hydroxyhexyl(pentyl)amino]ethyl (E)-but-2-enoate.
| Compound Name | 2-[2-hydroxyhexyl(pentyl)amino]ethyl (E)-but-2-enoate |
|---|---|
| PubChem CID | 102116780 |
| Molecular Formula | C17H33NO3 |
| Molecular Weight | 299.45 g/mol |
| Exact Mass | 299.25 |
| IUPAC Name | 2-[2-hydroxyhexyl(pentyl)amino]ethyl (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)OCCN(CCCCC)CC(O)CCCC |
| InChI | InChI=1S/C17H33NO3/c1-4-7-9-12-18(15-16(19)11-8-5-2)13-14-21-17(20)10-6-3/h6,10,16,19H,4-5,7-9,11-15H2,1-3H3/b10-6+ |
| InChIKey | BMMWWIIBCQCECX-UXBLZVDNSA-N |
| XLogP | 3.15 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|