C13H25NO3 — CID 102116758
2-[ethyl(2-hydroxypentyl)amino]ethyl (E)-but-2-enoate (PubChem CID 102116758) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-[ethyl(2-hydroxypentyl)amino]ethyl (E)-but-2-enoate.
| Compound Name | 2-[ethyl(2-hydroxypentyl)amino]ethyl (E)-but-2-enoate |
|---|---|
| PubChem CID | 102116758 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | 2-[ethyl(2-hydroxypentyl)amino]ethyl (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)OCCN(CC)CC(O)CCC |
| InChI | InChI=1S/C13H25NO3/c1-4-7-12(15)11-14(6-3)9-10-17-13(16)8-5-2/h5,8,12,15H,4,6-7,9-11H2,1-3H3/b8-5+ |
| InChIKey | TVFYBPZKOBPSMC-VMPITWQZSA-N |
| XLogP | 1.59 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|