C29H58O5Si3 — CID 102116971
trimethylsilyl 7-[(1S,2R,3R)-5-oxo-3-trimethylsilyloxy-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopentyl]heptanoate (PubChem CID 102116971) has the molecular formula C29H58O5Si3 and a molecular weight of 571.04 g/mol. Its IUPAC name is trimethylsilyl 7-[(1S,2R,3R)-5-oxo-3-trimethylsilyloxy-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopentyl]heptanoate.
| Compound Name | trimethylsilyl 7-[(1S,2R,3R)-5-oxo-3-trimethylsilyloxy-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 102116971 |
| Molecular Formula | C29H58O5Si3 |
| Molecular Weight | 571.04 g/mol |
| Exact Mass | 570.36 |
| IUPAC Name | trimethylsilyl 7-[(1S,2R,3R)-5-oxo-3-trimethylsilyloxy-2-[(E,3S)-3-trimethylsilyloxyoct-1-enyl]cyclopentyl]heptanoate |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1[C@H](CCCCCCC(=O)O[Si](C)(C)C)C(=O)C[C@H]1O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C29H58O5Si3/c1-11-12-15-18-24(32-35(2,3)4)21-22-26-25(27(30)23-28(26)33-36(5,6)7)19-16-13-14-17-20-29(31)34-37(8,9)10/h21-22,24-26,28H,11-20,23H2,1-10H3/b22-21+/t24-,25-,26+,28+/m0/s1 |
| InChIKey | VGJFFXDXFMPCDW-DSWMYNOBSA-N |
| XLogP | 8.49 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.04 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|