C25H41BO5 — CID 102118451
(3R,5R,8S,9S,10S,11S,13S,14S,17R)-2'-butyl-3,11-dihydroxy-10,13-dimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,4'-1,3,2-dioxaborinane]-5'-one (PubChem CID 102118451) has the molecular formula C25H41BO5 and a molecular weight of 432.41 g/mol. Its IUPAC name is (3R,5R,8S,9S,10S,11S,13S,14S,17R)-2'-butyl-3,11-dihydroxy-10,13-dimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,4'-1,3,2-dioxaborinane]-5'-one.
| Compound Name | (3R,5R,8S,9S,10S,11S,13S,14S,17R)-2'-butyl-3,11-dihydroxy-10,13-dimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,4'-1,3,2-dioxaborinane]-5'-one |
|---|---|
| PubChem CID | 102118451 |
| Molecular Formula | C25H41BO5 |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.30 |
| IUPAC Name | (3R,5R,8S,9S,10S,11S,13S,14S,17R)-2'-butyl-3,11-dihydroxy-10,13-dimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,4'-1,3,2-dioxaborinane]-5'-one |
| SMILES | CCCCB1OCC(=O)[C@]2(CC[C@H]3[C@@H]4CC[C@@H]5C[C@H](O)CC[C@]5(C)[C@H]4[C@@H](O)C[C@@]32C)O1 |
| InChI | InChI=1S/C25H41BO5/c1-4-5-12-26-30-15-21(29)25(31-26)11-9-19-18-7-6-16-13-17(27)8-10-23(16,2)22(18)20(28)14-24(19,25)3/h16-20,22,27-28H,4-15H2,1-3H3/t16-,17-,18+,19+,20+,22-,23+,24+,25+/m1/s1 |
| InChIKey | SICXOPFXEYPLNJ-NHOVEWACSA-N |
| XLogP | 4.00 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|