C25H43BO4 — CID 101287042
(3R,5R,5'R,8S,9S,10S,11S,13S,14S,17R)-2'-tert-butyl-5',10,13-trimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,4'-1,3,2-dioxaborolane]-3,11-diol (PubChem CID 101287042) has the molecular formula C25H43BO4 and a molecular weight of 418.43 g/mol. Its IUPAC name is (3R,5R,5'R,8S,9S,10S,11S,13S,14S,17R)-2'-tert-butyl-5',10,13-trimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,4'-1,3,2-dioxaborolane]-3,11-diol.
| Compound Name | (3R,5R,5'R,8S,9S,10S,11S,13S,14S,17R)-2'-tert-butyl-5',10,13-trimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,4'-1,3,2-dioxaborolane]-3,11-diol |
|---|---|
| PubChem CID | 101287042 |
| Molecular Formula | C25H43BO4 |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.33 |
| IUPAC Name | (3R,5R,5'R,8S,9S,10S,11S,13S,14S,17R)-2'-tert-butyl-5',10,13-trimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,4'-1,3,2-dioxaborolane]-3,11-diol |
| SMILES | C[C@H]1OB(C(C)(C)C)O[C@@]12CC[C@H]1[C@@H]3CC[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]12C |
| InChI | InChI=1S/C25H43BO4/c1-15-25(30-26(29-15)22(2,3)4)12-10-19-18-8-7-16-13-17(27)9-11-23(16,5)21(18)20(28)14-24(19,25)6/h15-21,27-28H,7-14H2,1-6H3/t15-,16-,17-,18+,19+,20+,21-,23+,24+,25+/m1/s1 |
| InChIKey | QTIKDUBAJZTYOF-WCWBBAPDSA-N |
| XLogP | 4.82 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|