C22H37BO3 — CID 101288399
(3R,5R,5'R,8R,9S,10S,13S,14S,17R)-2',5',10,13-tetramethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,4'-1,3,2-dioxaborolane]-3-ol (PubChem CID 101288399) has the molecular formula C22H37BO3 and a molecular weight of 360.35 g/mol. Its IUPAC name is (3R,5R,5'R,8R,9S,10S,13S,14S,17R)-2',5',10,13-tetramethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,4'-1,3,2-dioxaborolane]-3-ol.
| Compound Name | (3R,5R,5'R,8R,9S,10S,13S,14S,17R)-2',5',10,13-tetramethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,4'-1,3,2-dioxaborolane]-3-ol |
|---|---|
| PubChem CID | 101288399 |
| Molecular Formula | C22H37BO3 |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.28 |
| IUPAC Name | (3R,5R,5'R,8R,9S,10S,13S,14S,17R)-2',5',10,13-tetramethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,4'-1,3,2-dioxaborolane]-3-ol |
| SMILES | CB1O[C@H](C)[C@]2(CC[C@H]3[C@@H]4CC[C@@H]5C[C@H](O)CC[C@]5(C)[C@H]4CC[C@@]32C)O1 |
| InChI | InChI=1S/C22H37BO3/c1-14-22(26-23(4)25-14)12-9-19-17-6-5-15-13-16(24)7-10-20(15,2)18(17)8-11-21(19,22)3/h14-19,24H,5-13H2,1-4H3/t14-,15-,16-,17-,18+,19+,20+,21+,22+/m1/s1 |
| InChIKey | IVXGLDZOCJYIHH-BRQDPECCSA-N |
| XLogP | 4.68 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|