C25H43BO3 — CID 101288115
(3R,5R,5'S,8R,9S,10S,13S,14S,17S)-2'-tert-butyl-5',10,13-trimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,4'-1,3,2-dioxaborolane]-3-ol (PubChem CID 101288115) has the molecular formula C25H43BO3 and a molecular weight of 402.43 g/mol. Its IUPAC name is (3R,5R,5'S,8R,9S,10S,13S,14S,17S)-2'-tert-butyl-5',10,13-trimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,4'-1,3,2-dioxaborolane]-3-ol.
| Compound Name | (3R,5R,5'S,8R,9S,10S,13S,14S,17S)-2'-tert-butyl-5',10,13-trimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,4'-1,3,2-dioxaborolane]-3-ol |
|---|---|
| PubChem CID | 101288115 |
| Molecular Formula | C25H43BO3 |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.33 |
| IUPAC Name | (3R,5R,5'S,8R,9S,10S,13S,14S,17S)-2'-tert-butyl-5',10,13-trimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,4'-1,3,2-dioxaborolane]-3-ol |
| SMILES | C[C@@H]1OB(C(C)(C)C)O[C@]12CC[C@H]1[C@@H]3CC[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]12C |
| InChI | InChI=1S/C25H43BO3/c1-16-25(29-26(28-16)22(2,3)4)14-11-21-19-8-7-17-15-18(27)9-12-23(17,5)20(19)10-13-24(21,25)6/h16-21,27H,7-15H2,1-6H3/t16-,17+,18+,19+,20-,21-,23-,24-,25+/m0/s1 |
| InChIKey | KIVZCERHRUVXFW-VRHGLWERSA-N |
| XLogP | 5.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|