C6H4OS5 — CID 102119439
5-(hydroxymethyl)-[1,3]dithiolo[4,5-b][1,4]dithiine-2-thione (PubChem CID 102119439) has the molecular formula C6H4OS5 and a molecular weight of 252.43 g/mol. Its IUPAC name is 5-(hydroxymethyl)-[1,3]dithiolo[4,5-b][1,4]dithiine-2-thione.
| Compound Name | 5-(hydroxymethyl)-[1,3]dithiolo[4,5-b][1,4]dithiine-2-thione |
|---|---|
| PubChem CID | 102119439 |
| Molecular Formula | C6H4OS5 |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 251.89 |
| IUPAC Name | 5-(hydroxymethyl)-[1,3]dithiolo[4,5-b][1,4]dithiine-2-thione |
| SMILES | OCC1=CSc2sc(=S)sc2S1 |
| InChI | InChI=1S/C6H4OS5/c7-1-3-2-9-4-5(10-3)12-6(8)11-4/h2,7H,1H2 |
| InChIKey | JHHJUGAHZJIVHC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|