About [2-(1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]methanol
[2-(1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]methanol (PubChem CID 10900582) has the molecular formula C7H6OS4
and a molecular weight of 234.39 g/mol. Its IUPAC name is [2-(1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]methanol.
Analyze [2-(1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]methanol?
The IUPAC name of [2-(1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]methanol (CID 10900582) is [2-(1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]methanol.
What is the SMILES notation for [2-(1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]methanol?
The canonical SMILES for [2-(1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]methanol is OCC1=CSC(=C2SC=CS2)S1.
What is the InChIKey of [2-(1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]methanol?
The InChIKey is VYGCDOZSXPBPLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6OS4/c8-3-5-4-11-7(12-5)6-9-1-2-10-6/h1-2,4,8H,3H2.
What are the key properties of [2-(1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]methanol?
[2-(1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]methanol has a molecular weight of 234.39 g/mol, XLogP of 3.38, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,3-dithiol-2-ylidene)-1,3-dithiol-4-yl]methanol is sourced from PubChem (CID 10900582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).