C17H26O6Si — CID 102119460
diethyl 2-oxo-3-trimethylsilyl-4,5,7,7a-tetrahydro-1-benzofuran-6,6-dicarboxylate (PubChem CID 102119460) has the molecular formula C17H26O6Si and a molecular weight of 354.48 g/mol. Its IUPAC name is diethyl 2-oxo-3-trimethylsilyl-4,5,7,7a-tetrahydro-1-benzofuran-6,6-dicarboxylate.
| Compound Name | diethyl 2-oxo-3-trimethylsilyl-4,5,7,7a-tetrahydro-1-benzofuran-6,6-dicarboxylate |
|---|---|
| PubChem CID | 102119460 |
| Molecular Formula | C17H26O6Si |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | diethyl 2-oxo-3-trimethylsilyl-4,5,7,7a-tetrahydro-1-benzofuran-6,6-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CCC2=C([Si](C)(C)C)C(=O)OC2C1 |
| InChI | InChI=1S/C17H26O6Si/c1-6-21-15(19)17(16(20)22-7-2)9-8-11-12(10-17)23-14(18)13(11)24(3,4)5/h12H,6-10H2,1-5H3 |
| InChIKey | OOJWBJVHJCLYKV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|