C29H46O8Si — CID 11038929
tetramethyl 4-tributylsilyl-1,3,4,7-tetrahydroindene-2,2,5,6-tetracarboxylate (PubChem CID 11038929) has the molecular formula C29H46O8Si and a molecular weight of 550.77 g/mol. Its IUPAC name is tetramethyl 4-tributylsilyl-1,3,4,7-tetrahydroindene-2,2,5,6-tetracarboxylate.
| Compound Name | tetramethyl 4-tributylsilyl-1,3,4,7-tetrahydroindene-2,2,5,6-tetracarboxylate |
|---|---|
| PubChem CID | 11038929 |
| Molecular Formula | C29H46O8Si |
| Molecular Weight | 550.77 g/mol |
| Exact Mass | 550.30 |
| IUPAC Name | tetramethyl 4-tributylsilyl-1,3,4,7-tetrahydroindene-2,2,5,6-tetracarboxylate |
| SMILES | CCCC[Si](CCCC)(CCCC)C1C2=C(CC(C(=O)OC)=C1C(=O)OC)CC(C(=O)OC)(C(=O)OC)C2 |
| InChI | InChI=1S/C29H46O8Si/c1-8-11-14-38(15-12-9-2,16-13-10-3)24-22-19-29(27(32)36-6,28(33)37-7)18-20(22)17-21(25(30)34-4)23(24)26(31)35-5/h24H,8-19H2,1-7H3 |
| InChIKey | PYAKASLEPICLOV-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.77 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|