C19H34O4Si — CID 15460074
methyl (1S,2R)-3-butyl-2-[tert-butyl(dimethyl)silyl]oxy-1,4-dimethyl-5-oxocyclopent-3-ene-1-carboxylate (PubChem CID 15460074) has the molecular formula C19H34O4Si and a molecular weight of 354.56 g/mol. Its IUPAC name is methyl (1S,2R)-3-butyl-2-[tert-butyl(dimethyl)silyl]oxy-1,4-dimethyl-5-oxocyclopent-3-ene-1-carboxylate.
| Compound Name | methyl (1S,2R)-3-butyl-2-[tert-butyl(dimethyl)silyl]oxy-1,4-dimethyl-5-oxocyclopent-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 15460074 |
| Molecular Formula | C19H34O4Si |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | methyl (1S,2R)-3-butyl-2-[tert-butyl(dimethyl)silyl]oxy-1,4-dimethyl-5-oxocyclopent-3-ene-1-carboxylate |
| SMILES | CCCCC1=C(C)C(=O)[C@@](C)(C(=O)OC)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H34O4Si/c1-10-11-12-14-13(2)15(20)19(6,17(21)22-7)16(14)23-24(8,9)18(3,4)5/h16H,10-12H2,1-9H3/t16-,19-/m1/s1 |
| InChIKey | NPQGXNARKOEMBI-VQIMIIECSA-N |
| XLogP | 4.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|