C20H32O5Si — CID 102255094
dimethyl 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3,4,5-tetrahydroindene-2,2-dicarboxylate (PubChem CID 102255094) has the molecular formula C20H32O5Si and a molecular weight of 380.56 g/mol. Its IUPAC name is dimethyl 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3,4,5-tetrahydroindene-2,2-dicarboxylate.
| Compound Name | dimethyl 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3,4,5-tetrahydroindene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 102255094 |
| Molecular Formula | C20H32O5Si |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | dimethyl 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3,4,5-tetrahydroindene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2=C(CCC(CO[Si](C)(C)C(C)(C)C)=C2)C1 |
| InChI | InChI=1S/C20H32O5Si/c1-19(2,3)26(6,7)25-13-14-8-9-15-11-20(17(21)23-4,18(22)24-5)12-16(15)10-14/h10H,8-9,11-13H2,1-7H3 |
| InChIKey | SKOJXBBLDNNOGP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|