C21H34O4Si — CID 101219663
dimethyl (5E)-4-[(E)-hept-1-enyl]-5-(trimethylsilylmethylidene)cyclohex-3-ene-1,1-dicarboxylate (PubChem CID 101219663) has the molecular formula C21H34O4Si and a molecular weight of 378.59 g/mol. Its IUPAC name is dimethyl (5E)-4-[(E)-hept-1-enyl]-5-(trimethylsilylmethylidene)cyclohex-3-ene-1,1-dicarboxylate.
| Compound Name | dimethyl (5E)-4-[(E)-hept-1-enyl]-5-(trimethylsilylmethylidene)cyclohex-3-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 101219663 |
| Molecular Formula | C21H34O4Si |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | dimethyl (5E)-4-[(E)-hept-1-enyl]-5-(trimethylsilylmethylidene)cyclohex-3-ene-1,1-dicarboxylate |
| SMILES | CCCCC/C=C/C1=CCC(C(=O)OC)(C(=O)OC)C/C1=C\[Si](C)(C)C |
| InChI | InChI=1S/C21H34O4Si/c1-7-8-9-10-11-12-17-13-14-21(19(22)24-2,20(23)25-3)15-18(17)16-26(4,5)6/h11-13,16H,7-10,14-15H2,1-6H3/b12-11+,18-16+ |
| InChIKey | RUMKNTANVRRSGR-RTPSZKKVSA-N |
| XLogP | 4.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|