C17H26O5Si — CID 135068431
dimethyl 6-(trimethylsilyloxymethyl)-1,3,4,5-tetrahydroindene-2,2-dicarboxylate (PubChem CID 135068431) has the molecular formula C17H26O5Si and a molecular weight of 338.48 g/mol. Its IUPAC name is dimethyl 6-(trimethylsilyloxymethyl)-1,3,4,5-tetrahydroindene-2,2-dicarboxylate.
| Compound Name | dimethyl 6-(trimethylsilyloxymethyl)-1,3,4,5-tetrahydroindene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 135068431 |
| Molecular Formula | C17H26O5Si |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | dimethyl 6-(trimethylsilyloxymethyl)-1,3,4,5-tetrahydroindene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2=C(CCC(CO[Si](C)(C)C)=C2)C1 |
| InChI | InChI=1S/C17H26O5Si/c1-20-15(18)17(16(19)21-2)9-13-7-6-12(8-14(13)10-17)11-22-23(3,4)5/h8H,6-7,9-11H2,1-5H3 |
| InChIKey | NTEMMGMGUHXJQO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|