C21H28O4 — CID 15634045
diethyl 3a-methyl-2-methylidene-1,3,4,5,7,9-hexahydrocyclopenta[a]naphthalene-8,8-dicarboxylate (PubChem CID 15634045) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is diethyl 3a-methyl-2-methylidene-1,3,4,5,7,9-hexahydrocyclopenta[a]naphthalene-8,8-dicarboxylate.
| Compound Name | diethyl 3a-methyl-2-methylidene-1,3,4,5,7,9-hexahydrocyclopenta[a]naphthalene-8,8-dicarboxylate |
|---|---|
| PubChem CID | 15634045 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | diethyl 3a-methyl-2-methylidene-1,3,4,5,7,9-hexahydrocyclopenta[a]naphthalene-8,8-dicarboxylate |
| SMILES | C=C1CC2=C3CC(C(=O)OCC)(C(=O)OCC)CC=C3CCC2(C)C1 |
| InChI | InChI=1S/C21H28O4/c1-5-24-18(22)21(19(23)25-6-2)10-8-15-7-9-20(4)12-14(3)11-17(20)16(15)13-21/h8H,3,5-7,9-13H2,1-2,4H3 |
| InChIKey | JDRNEJKBPRLTNT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|