C19H26O4 — CID 11493439
dimethyl (3aS,7aR)-3-(cyclohexen-1-yl)-3a,4,5,6,7,7a-hexahydroindene-1,1-dicarboxylate (PubChem CID 11493439) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is dimethyl (3aS,7aR)-3-(cyclohexen-1-yl)-3a,4,5,6,7,7a-hexahydroindene-1,1-dicarboxylate.
| Compound Name | dimethyl (3aS,7aR)-3-(cyclohexen-1-yl)-3a,4,5,6,7,7a-hexahydroindene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11493439 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | dimethyl (3aS,7aR)-3-(cyclohexen-1-yl)-3a,4,5,6,7,7a-hexahydroindene-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C=C(C2=CCCCC2)[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C19H26O4/c1-22-17(20)19(18(21)23-2)12-15(13-8-4-3-5-9-13)14-10-6-7-11-16(14)19/h8,12,14,16H,3-7,9-11H2,1-2H3/t14-,16-/m1/s1 |
| InChIKey | CYYZVXRQKJMXEJ-GDBMZVCRSA-N |
| XLogP | 3.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|