C21H28O4 — CID 11302362
dimethyl 7-tert-butyl-6-ethenylspiro[3,4-dihydro-1H-indene-5,1'-cyclopropane]-2,2-dicarboxylate (PubChem CID 11302362) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is dimethyl 7-tert-butyl-6-ethenylspiro[3,4-dihydro-1H-indene-5,1'-cyclopropane]-2,2-dicarboxylate.
| Compound Name | dimethyl 7-tert-butyl-6-ethenylspiro[3,4-dihydro-1H-indene-5,1'-cyclopropane]-2,2-dicarboxylate |
|---|---|
| PubChem CID | 11302362 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | dimethyl 7-tert-butyl-6-ethenylspiro[3,4-dihydro-1H-indene-5,1'-cyclopropane]-2,2-dicarboxylate |
| SMILES | C=CC1=C(C(C)(C)C)C2=C(CC13CC3)CC(C(=O)OC)(C(=O)OC)C2 |
| InChI | InChI=1S/C21H28O4/c1-7-15-16(19(2,3)4)14-12-21(17(22)24-5,18(23)25-6)11-13(14)10-20(15)8-9-20/h7H,1,8-12H2,2-6H3 |
| InChIKey | KOTCQUZZRDSPHU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|